C22H28N4O2S — CID 139641288
2-[[8-(1H-benzimidazol-2-ylsulfinylmethyl)-1-ethyl-3,4-dihydro-2H-quinolin-6-yl]-methylamino]ethanol (PubChem CID 139641288) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-[[8-(1H-benzimidazol-2-ylsulfinylmethyl)-1-ethyl-3,4-dihydro-2H-quinolin-6-yl]-methylamino]ethanol.
| Compound Name | 2-[[8-(1H-benzimidazol-2-ylsulfinylmethyl)-1-ethyl-3,4-dihydro-2H-quinolin-6-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 139641288 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[[8-(1H-benzimidazol-2-ylsulfinylmethyl)-1-ethyl-3,4-dihydro-2H-quinolin-6-yl]-methylamino]ethanol |
| SMILES | CCN1CCCc2cc(N(C)CCO)cc(CS(=O)c3nc4ccccc4[nH]3)c21 |
| InChI | InChI=1S/C22H28N4O2S/c1-3-26-10-6-7-16-13-18(25(2)11-12-27)14-17(21(16)26)15-29(28)22-23-19-8-4-5-9-20(19)24-22/h4-5,8-9,13-14,27H,3,6-7,10-12,15H2,1-2H3,(H,23,24) |
| InChIKey | RIYLFXXQWAJZDR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|