C24H23N3OS — CID 15053225
8-(1H-benzimidazol-2-ylsulfinylmethyl)-1-benzyl-3,4-dihydro-2H-quinoline (PubChem CID 15053225) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is 8-(1H-benzimidazol-2-ylsulfinylmethyl)-1-benzyl-3,4-dihydro-2H-quinoline.
| Compound Name | 8-(1H-benzimidazol-2-ylsulfinylmethyl)-1-benzyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 15053225 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 8-(1H-benzimidazol-2-ylsulfinylmethyl)-1-benzyl-3,4-dihydro-2H-quinoline |
| SMILES | O=S(Cc1cccc2c1N(Cc1ccccc1)CCC2)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H23N3OS/c28-29(24-25-21-13-4-5-14-22(21)26-24)17-20-11-6-10-19-12-7-15-27(23(19)20)16-18-8-2-1-3-9-18/h1-6,8-11,13-14H,7,12,15-17H2,(H,25,26) |
| InChIKey | HUUPUSKLONKZIU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |