C19H37NO — CID 139641351
N,2,3-tributylhept-2-enamide (PubChem CID 139641351) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is N,2,3-tributylhept-2-enamide.
| Compound Name | N,2,3-tributylhept-2-enamide |
|---|---|
| PubChem CID | 139641351 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | N,2,3-tributylhept-2-enamide |
| SMILES | CCCCNC(=O)C(CCCC)=C(CCCC)CCCC |
| InChI | InChI=1S/C19H37NO/c1-5-9-13-17(14-10-6-2)18(15-11-7-3)19(21)20-16-12-8-4/h5-16H2,1-4H3,(H,20,21) |
| InChIKey | PHIJBEAIKAHPOG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|