C18H17N7O5S4 — CID 139643795
(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[(Z)-4-(thiadiazol-5-ylsulfanyl)but-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 139643795) has the molecular formula C18H17N7O5S4 and a molecular weight of 539.65 g/mol. Its IUPAC name is (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[(Z)-4-(thiadiazol-5-ylsulfanyl)but-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[(Z)-4-(thiadiazol-5-ylsulfanyl)but-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 139643795 |
| Molecular Formula | C18H17N7O5S4 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[(Z)-4-(thiadiazol-5-ylsulfanyl)but-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Nc1nc(C(=NO)C(=O)N[C@@H]2C(=O)N3C(C(=O)O)=C(/C=C\CCSc4cnns4)CS[C@H]23)cs1 |
| InChI | InChI=1S/C18H17N7O5S4/c19-18-21-9(7-33-18)11(23-30)14(26)22-12-15(27)25-13(17(28)29)8(6-32-16(12)25)3-1-2-4-31-10-5-20-24-34-10/h1,3,5,7,12,16,30H,2,4,6H2,(H2,19,21)(H,22,26)(H,28,29)/b3-1-,23-11?/t12-,16-/m1/s1 |
| InChIKey | VKDYKQSQWFPHGT-BURRLZIOSA-N |
| XLogP | 1.23 |
| TPSA | 183.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|