C17H18N6O6S2 — CID 139643812
(6R,7R)-3-[(Z)-5-amino-5-oxopent-1-enyl]-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 139643812) has the molecular formula C17H18N6O6S2 and a molecular weight of 466.50 g/mol. Its IUPAC name is (6R,7R)-3-[(Z)-5-amino-5-oxopent-1-enyl]-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-[(Z)-5-amino-5-oxopent-1-enyl]-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 139643812 |
| Molecular Formula | C17H18N6O6S2 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | (6R,7R)-3-[(Z)-5-amino-5-oxopent-1-enyl]-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NC(=O)CC/C=C\C1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)C(=NO)c3csc(N)n3)[C@H]2SC1 |
| InChI | InChI=1S/C17H18N6O6S2/c18-9(24)4-2-1-3-7-5-30-15-11(14(26)23(15)12(7)16(27)28)21-13(25)10(22-29)8-6-31-17(19)20-8/h1,3,6,11,15,29H,2,4-5H2,(H2,18,24)(H2,19,20)(H,21,25)(H,27,28)/b3-1-,22-10?/t11-,15-/m1/s1 |
| InChIKey | BYKSBYXWUPWVOQ-NGQFUDMNSA-N |
| XLogP | -0.54 |
| TPSA | 201.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|