C11H12N2O4 — CID 139644245
2-(2-phenylpropan-2-yl)-1,4,2,3-dioxadiazinane-5,6-dione (PubChem CID 139644245) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-(2-phenylpropan-2-yl)-1,4,2,3-dioxadiazinane-5,6-dione.
| Compound Name | 2-(2-phenylpropan-2-yl)-1,4,2,3-dioxadiazinane-5,6-dione |
|---|---|
| PubChem CID | 139644245 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-(2-phenylpropan-2-yl)-1,4,2,3-dioxadiazinane-5,6-dione |
| SMILES | CC(C)(c1ccccc1)N1NOC(=O)C(=O)O1 |
| InChI | InChI=1S/C11H12N2O4/c1-11(2,8-6-4-3-5-7-8)13-12-16-9(14)10(15)17-13/h3-7,12H,1-2H3 |
| InChIKey | MLRXLHMUHDOPCE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|