C27H28N4O4 — CID 139644366
[2-(benzotriazol-2-yl)-4,6-di(butan-2-yl)phenyl] 4-nitrobenzoate (PubChem CID 139644366) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is [2-(benzotriazol-2-yl)-4,6-di(butan-2-yl)phenyl] 4-nitrobenzoate.
| Compound Name | [2-(benzotriazol-2-yl)-4,6-di(butan-2-yl)phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 139644366 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | [2-(benzotriazol-2-yl)-4,6-di(butan-2-yl)phenyl] 4-nitrobenzoate |
| SMILES | CCC(C)c1cc(C(C)CC)c(OC(=O)c2ccc([N+](=O)[O-])cc2)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C27H28N4O4/c1-5-17(3)20-15-22(18(4)6-2)26(35-27(32)19-11-13-21(14-12-19)31(33)34)25(16-20)30-28-23-9-7-8-10-24(23)29-30/h7-18H,5-6H2,1-4H3 |
| InChIKey | JBDPBPKEYSHGBP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|