C14H28Br2O2 — CID 139648621
2,3-bis(4-bromobutoxy)-2,3-dimethylbutane (PubChem CID 139648621) has the molecular formula C14H28Br2O2 and a molecular weight of 388.18 g/mol. Its IUPAC name is 2,3-bis(4-bromobutoxy)-2,3-dimethylbutane.
| Compound Name | 2,3-bis(4-bromobutoxy)-2,3-dimethylbutane |
|---|---|
| PubChem CID | 139648621 |
| Molecular Formula | C14H28Br2O2 |
| Molecular Weight | 388.18 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 2,3-bis(4-bromobutoxy)-2,3-dimethylbutane |
| SMILES | CC(C)(OCCCCBr)C(C)(C)OCCCCBr |
| InChI | InChI=1S/C14H28Br2O2/c1-13(2,17-11-7-5-9-15)14(3,4)18-12-8-6-10-16/h5-12H2,1-4H3 |
| InChIKey | QPFSARPWDOXBBG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.18 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|