C23H35BrO2 — CID 139649133
(8R,9S,10R,13S,14S)-3-(4-bromobutoxy)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 139649133) has the molecular formula C23H35BrO2 and a molecular weight of 423.44 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-3-(4-bromobutoxy)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-3-(4-bromobutoxy)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 139649133 |
| Molecular Formula | C23H35BrO2 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (8R,9S,10R,13S,14S)-3-(4-bromobutoxy)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(OCCCCBr)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H35BrO2/c1-22-11-9-17(26-14-4-3-13-24)15-16(22)5-6-18-19-7-8-21(25)23(19,2)12-10-20(18)22/h5,17-20H,3-4,6-15H2,1-2H3/t17?,18-,19-,20-,22-,23-/m0/s1 |
| InChIKey | SDUHPJCMBNJBDN-OPSVTXQQSA-N |
| XLogP | 6.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|