C51H48Br9O4P — CID 139650290
tris(1,1,3-tribromo-2,2-dimethyl-3,3-diphenylpropyl) phosphate (PubChem CID 139650290) has the molecular formula C51H48Br9O4P and a molecular weight of 1475.05 g/mol. Its IUPAC name is tris(1,1,3-tribromo-2,2-dimethyl-3,3-diphenylpropyl) phosphate.
| Compound Name | tris(1,1,3-tribromo-2,2-dimethyl-3,3-diphenylpropyl) phosphate |
|---|---|
| PubChem CID | 139650290 |
| Molecular Formula | C51H48Br9O4P |
| Molecular Weight | 1475.05 g/mol |
| Exact Mass | 1465.59 |
| IUPAC Name | tris(1,1,3-tribromo-2,2-dimethyl-3,3-diphenylpropyl) phosphate |
| SMILES | CC(C)(C(Br)(Br)OP(=O)(OC(Br)(Br)C(C)(C)C(Br)(c1ccccc1)c1ccccc1)OC(Br)(Br)C(C)(C)C(Br)(c1ccccc1)c1ccccc1)C(Br)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H48Br9O4P/c1-43(2,46(52,37-25-13-7-14-26-37)38-27-15-8-16-28-38)49(55,56)62-65(61,63-50(57,58)44(3,4)47(53,39-29-17-9-18-30-39)40-31-19-10-20-32-40)64-51(59,60)45(5,6)48(54,41-33-21-11-22-34-41)42-35-23-12-24-36-42/h7-36H,1-6H3 |
| InChIKey | PIGQVZLYCKFERP-UHFFFAOYSA-N |
| XLogP | 19.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1475.05 |
| LogP ≤ 5 | 19.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|