C6H7N7 — CID 139650543
4,4-diazidocyclohexa-1,5-dien-1-amine (PubChem CID 139650543) has the molecular formula C6H7N7 and a molecular weight of 177.17 g/mol. Its IUPAC name is 4,4-diazidocyclohexa-1,5-dien-1-amine.
| Compound Name | 4,4-diazidocyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 139650543 |
| Molecular Formula | C6H7N7 |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4,4-diazidocyclohexa-1,5-dien-1-amine |
| SMILES | [N-]=[N+]=NC1(N=[N+]=[N-])C=CC(N)=CC1 |
| InChI | InChI=1S/C6H7N7/c7-5-1-3-6(4-2-5,10-12-8)11-13-9/h1-3H,4,7H2 |
| InChIKey | NSRZYAZHAQXPLH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|