C19H18O4 — CID 139651340
2-(4-methylphenoxy)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid (PubChem CID 139651340) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-(4-methylphenoxy)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 139651340 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-(4-methylphenoxy)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid |
| SMILES | C=CCOc1ccc(C=C(Oc2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H18O4/c1-3-12-22-16-10-6-15(7-11-16)13-18(19(20)21)23-17-8-4-14(2)5-9-17/h3-11,13H,1,12H2,2H3,(H,20,21) |
| InChIKey | XHYGZPKTVMVZEH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|