C23H28N2O3S — CID 139651763
methyl 3-[4-[3-(dimethylamino)propoxy]phenyl]-6-propan-2-ylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 139651763) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is methyl 3-[4-[3-(dimethylamino)propoxy]phenyl]-6-propan-2-ylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | methyl 3-[4-[3-(dimethylamino)propoxy]phenyl]-6-propan-2-ylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 139651763 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | methyl 3-[4-[3-(dimethylamino)propoxy]phenyl]-6-propan-2-ylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1sc2nc(C(C)C)ccc2c1-c1ccc(OCCCN(C)C)cc1 |
| InChI | InChI=1S/C23H28N2O3S/c1-15(2)19-12-11-18-20(21(23(26)27-5)29-22(18)24-19)16-7-9-17(10-8-16)28-14-6-13-25(3)4/h7-12,15H,6,13-14H2,1-5H3 |
| InChIKey | RQEBLBDPZXSUEU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|