C21H17NO3S — CID 97032780
methyl 3-(4-ethoxyphenyl)thieno[3,2-c]quinoline-2-carboxylate (PubChem CID 97032780) has the molecular formula C21H17NO3S and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl 3-(4-ethoxyphenyl)thieno[3,2-c]quinoline-2-carboxylate.
| Compound Name | methyl 3-(4-ethoxyphenyl)thieno[3,2-c]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 97032780 |
| Molecular Formula | C21H17NO3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | methyl 3-(4-ethoxyphenyl)thieno[3,2-c]quinoline-2-carboxylate |
| SMILES | CCOc1ccc(-c2c(C(=O)OC)sc3c2cnc2ccccc23)cc1 |
| InChI | InChI=1S/C21H17NO3S/c1-3-25-14-10-8-13(9-11-14)18-16-12-22-17-7-5-4-6-15(17)19(16)26-20(18)21(23)24-2/h4-12H,3H2,1-2H3 |
| InChIKey | JCIPCQYBUMJDOA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |