C21H17ClN2O2S — CID 50776757
3-(4-chlorophenyl)-N-(2-hydroxypropyl)thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 50776757) has the molecular formula C21H17ClN2O2S and a molecular weight of 396.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(2-hydroxypropyl)thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-(2-hydroxypropyl)thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 50776757 |
| Molecular Formula | C21H17ClN2O2S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(2-hydroxypropyl)thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CC(O)CNC(=O)c1sc2c(cnc3ccccc32)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClN2O2S/c1-12(25)10-24-21(26)20-18(13-6-8-14(22)9-7-13)16-11-23-17-5-3-2-4-15(17)19(16)27-20/h2-9,11-12,25H,10H2,1H3,(H,24,26) |
| InChIKey | GMKYJBAIVZDTSZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |