C25H26N2O2S — CID 50776625
8-methyl-3-phenyl-N-(3-propan-2-yloxypropyl)thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 50776625) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is 8-methyl-3-phenyl-N-(3-propan-2-yloxypropyl)thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 8-methyl-3-phenyl-N-(3-propan-2-yloxypropyl)thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 50776625 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 8-methyl-3-phenyl-N-(3-propan-2-yloxypropyl)thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | Cc1ccc2ncc3c(-c4ccccc4)c(C(=O)NCCCOC(C)C)sc3c2c1 |
| InChI | InChI=1S/C25H26N2O2S/c1-16(2)29-13-7-12-26-25(28)24-22(18-8-5-4-6-9-18)20-15-27-21-11-10-17(3)14-19(21)23(20)30-24/h4-6,8-11,14-16H,7,12-13H2,1-3H3,(H,26,28) |
| InChIKey | XIHLIDQEADHQOF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|