About 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate
7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate (PubChem CID 139651986) has the molecular formula C21H26FNO4
and a molecular weight of 375.44 g/mol. Its IUPAC name is 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate.
Molecular Properties
| Compound Name | 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate |
| PubChem CID | 139651986 |
| Molecular Formula | C21H26FNO4 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate |
| SMILES | COCC(=O)OC(C)CCCCCc1ccc(-c2ccc(O)c(F)c2)nc1 |
| InChI | InChI=1S/C21H26FNO4/c1-15(27-21(25)14-26-2)6-4-3-5-7-16-8-10-19(23-13-16)17-9-11-20(24)18(22)12-17/h8-13,15,24H,3-7,14H2,1-2H3 |
| InChIKey | CZOPLQNWFYUAPB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate?
The IUPAC name of 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate (CID 139651986) is 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate.
What is the SMILES notation for 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate?
The canonical SMILES for 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate is COCC(=O)OC(C)CCCCCc1ccc(-c2ccc(O)c(F)c2)nc1.
What is the InChIKey of 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate?
The InChIKey is CZOPLQNWFYUAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26FNO4/c1-15(27-21(25)14-26-2)6-4-3-5-7-16-8-10-19(23-13-16)17-9-11-20(24)18(22)12-17/h8-13,15,24H,3-7,14H2,1-2H3.
What are the key properties of 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate?
7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate has a molecular weight of 375.44 g/mol, XLogP of 4.27, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[6-(3-fluoro-4-hydroxyphenyl)-3-pyridinyl]heptan-2-yl 2-methoxyacetate is sourced from PubChem (CID 139651986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).