C51H43NO7 — CID 139655275
dibenzhydryl 2-(2-amino-1-hydroxy-2-oxoethyl)-2-(1-hydroxy-2,2,2-triphenylethyl)propanedioate (PubChem CID 139655275) has the molecular formula C51H43NO7 and a molecular weight of 781.91 g/mol. Its IUPAC name is dibenzhydryl 2-(2-amino-1-hydroxy-2-oxoethyl)-2-(1-hydroxy-2,2,2-triphenylethyl)propanedioate.
| Compound Name | dibenzhydryl 2-(2-amino-1-hydroxy-2-oxoethyl)-2-(1-hydroxy-2,2,2-triphenylethyl)propanedioate |
|---|---|
| PubChem CID | 139655275 |
| Molecular Formula | C51H43NO7 |
| Molecular Weight | 781.91 g/mol |
| Exact Mass | 781.30 |
| IUPAC Name | dibenzhydryl 2-(2-amino-1-hydroxy-2-oxoethyl)-2-(1-hydroxy-2,2,2-triphenylethyl)propanedioate |
| SMILES | NC(=O)C(O)C(C(=O)OC(c1ccccc1)c1ccccc1)(C(=O)OC(c1ccccc1)c1ccccc1)C(O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H43NO7/c52-46(54)45(53)51(48(56)58-43(36-22-8-1-9-23-36)37-24-10-2-11-25-37,49(57)59-44(38-26-12-3-13-27-38)39-28-14-4-15-29-39)47(55)50(40-30-16-5-17-31-40,41-32-18-6-19-33-41)42-34-20-7-21-35-42/h1-35,43-45,47,53,55H,(H2,52,54) |
| InChIKey | SZXJTGNRXCATQC-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.91 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|