C24H23ClF3N3O3 — CID 139656404
ethyl 5-(4-chlorophenyl)-2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]-4-prop-2-enyl-3H-pyrazole-4-carboxylate (PubChem CID 139656404) has the molecular formula C24H23ClF3N3O3 and a molecular weight of 493.91 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]-4-prop-2-enyl-3H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]-4-prop-2-enyl-3H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 139656404 |
| Molecular Formula | C24H23ClF3N3O3 |
| Molecular Weight | 493.91 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]-4-prop-2-enyl-3H-pyrazole-4-carboxylate |
| SMILES | C=CCC1(C(=O)OCC)CN(CC(=O)Nc2ccc(C(F)(F)F)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClF3N3O3/c1-3-13-23(22(33)34-4-2)15-31(30-21(23)16-5-9-18(25)10-6-16)14-20(32)29-19-11-7-17(8-12-19)24(26,27)28/h3,5-12H,1,4,13-15H2,2H3,(H,29,32) |
| InChIKey | UCXSLSNDAMWDQM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.91 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|