C22H23Cl2N3O — CID 139656528
2-[4-but-2-enyl-5-(4-chlorophenyl)-4-methyl-3H-pyrazol-2-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 139656528) has the molecular formula C22H23Cl2N3O and a molecular weight of 416.35 g/mol. Its IUPAC name is 2-[4-but-2-enyl-5-(4-chlorophenyl)-4-methyl-3H-pyrazol-2-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-but-2-enyl-5-(4-chlorophenyl)-4-methyl-3H-pyrazol-2-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 139656528 |
| Molecular Formula | C22H23Cl2N3O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-[4-but-2-enyl-5-(4-chlorophenyl)-4-methyl-3H-pyrazol-2-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | CC=CCC1(C)CN(CC(=O)Nc2ccc(Cl)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23Cl2N3O/c1-3-4-13-22(2)15-27(26-21(22)16-5-7-17(23)8-6-16)14-20(28)25-19-11-9-18(24)10-12-19/h3-12H,13-15H2,1-2H3,(H,25,28) |
| InChIKey | BPBXXMRXQDUYLT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|