About 3-bromo-2-nitropentane-1,1-diol
3-bromo-2-nitropentane-1,1-diol (PubChem CID 139656967) has the molecular formula C5H10BrNO4
and a molecular weight of 228.04 g/mol. Its IUPAC name is 3-bromo-2-nitropentane-1,1-diol.
Molecular Properties
| Compound Name | 3-bromo-2-nitropentane-1,1-diol |
| PubChem CID | 139656967 |
| Molecular Formula | C5H10BrNO4 |
| Molecular Weight | 228.04 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | 3-bromo-2-nitropentane-1,1-diol |
| SMILES | CCC(Br)C(C(O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C5H10BrNO4/c1-2-3(6)4(5(8)9)7(10)11/h3-5,8-9H,2H2,1H3 |
| InChIKey | YUVOUVQSELKCQF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.04 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-nitropentane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-nitropentane-1,1-diol?
The IUPAC name of 3-bromo-2-nitropentane-1,1-diol (CID 139656967) is 3-bromo-2-nitropentane-1,1-diol.
What is the SMILES notation for 3-bromo-2-nitropentane-1,1-diol?
The canonical SMILES for 3-bromo-2-nitropentane-1,1-diol is CCC(Br)C(C(O)O)[N+](=O)[O-].
What is the InChIKey of 3-bromo-2-nitropentane-1,1-diol?
The InChIKey is YUVOUVQSELKCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10BrNO4/c1-2-3(6)4(5(8)9)7(10)11/h3-5,8-9H,2H2,1H3.
What are the key properties of 3-bromo-2-nitropentane-1,1-diol?
3-bromo-2-nitropentane-1,1-diol has a molecular weight of 228.04 g/mol, XLogP of 0.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-nitropentane-1,1-diol is sourced from PubChem (CID 139656967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).