C26H30N2O3 — CID 139657535
[4-[2-(6-phenylmethoxyheptyl)pyrimidin-5-yl]phenyl] acetate (PubChem CID 139657535) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is [4-[2-(6-phenylmethoxyheptyl)pyrimidin-5-yl]phenyl] acetate.
| Compound Name | [4-[2-(6-phenylmethoxyheptyl)pyrimidin-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 139657535 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | [4-[2-(6-phenylmethoxyheptyl)pyrimidin-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2cnc(CCCCCC(C)OCc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-20(30-19-22-10-6-4-7-11-22)9-5-3-8-12-26-27-17-24(18-28-26)23-13-15-25(16-14-23)31-21(2)29/h4,6-7,10-11,13-18,20H,3,5,8-9,12,19H2,1-2H3 |
| InChIKey | QASVLRYYUPRMDS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|