C27H32N2O3 — CID 139657658
[4-[5-(7-phenylmethoxyoctyl)pyrimidin-2-yl]phenyl] acetate (PubChem CID 139657658) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is [4-[5-(7-phenylmethoxyoctyl)pyrimidin-2-yl]phenyl] acetate.
| Compound Name | [4-[5-(7-phenylmethoxyoctyl)pyrimidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 139657658 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | [4-[5-(7-phenylmethoxyoctyl)pyrimidin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2ncc(CCCCCCC(C)OCc3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C27H32N2O3/c1-21(31-20-23-11-8-5-9-12-23)10-6-3-4-7-13-24-18-28-27(29-19-24)25-14-16-26(17-15-25)32-22(2)30/h5,8-9,11-12,14-19,21H,3-4,6-7,10,13,20H2,1-2H3 |
| InChIKey | WTDMQILSMXTHDC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|