About 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one
6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one (PubChem CID 139658811) has the molecular formula C15H15N3O3
and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one |
| PubChem CID | 139658811 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one |
| SMILES | CCCc1nnc(-c2cc3cc(OC)ccc3[nH]c2=O)o1 |
| InChI | InChI=1S/C15H15N3O3/c1-3-4-13-17-18-15(21-13)11-8-9-7-10(20-2)5-6-12(9)16-14(11)19/h5-8H,3-4H2,1-2H3,(H,16,19) |
| InChIKey | SXNVGMXPBUERQV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one?
The IUPAC name of 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one (CID 139658811) is 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one.
What is the SMILES notation for 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one?
The canonical SMILES for 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one is CCCc1nnc(-c2cc3cc(OC)ccc3[nH]c2=O)o1.
What is the InChIKey of 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one?
The InChIKey is SXNVGMXPBUERQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O3/c1-3-4-13-17-18-15(21-13)11-8-9-7-10(20-2)5-6-12(9)16-14(11)19/h5-8H,3-4H2,1-2H3,(H,16,19).
What are the key properties of 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one?
6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one has a molecular weight of 285.30 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1H-quinolin-2-one is sourced from PubChem (CID 139658811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).