About 4-benzylbenzenesulfonyl fluoride
4-benzylbenzenesulfonyl fluoride (PubChem CID 139660106) has the molecular formula C13H11FO2S
and a molecular weight of 250.29 g/mol. Its IUPAC name is 4-benzylbenzenesulfonyl fluoride.
Molecular Properties
| Compound Name | 4-benzylbenzenesulfonyl fluoride |
| PubChem CID | 139660106 |
| Molecular Formula | C13H11FO2S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-benzylbenzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11FO2S/c14-17(15,16)13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | JPFRRXPAHWCKCM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzylbenzenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylbenzenesulfonyl fluoride?
The IUPAC name of 4-benzylbenzenesulfonyl fluoride (CID 139660106) is 4-benzylbenzenesulfonyl fluoride.
What is the SMILES notation for 4-benzylbenzenesulfonyl fluoride?
The canonical SMILES for 4-benzylbenzenesulfonyl fluoride is O=S(=O)(F)c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of 4-benzylbenzenesulfonyl fluoride?
The InChIKey is JPFRRXPAHWCKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FO2S/c14-17(15,16)13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2.
What are the key properties of 4-benzylbenzenesulfonyl fluoride?
4-benzylbenzenesulfonyl fluoride has a molecular weight of 250.29 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylbenzenesulfonyl fluoride is sourced from PubChem (CID 139660106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).