About isoquinolin-4-yl 2-nitroacetate
isoquinolin-4-yl 2-nitroacetate (PubChem CID 139660360) has the molecular formula C11H8N2O4
and a molecular weight of 232.20 g/mol. Its IUPAC name is isoquinolin-4-yl 2-nitroacetate.
Molecular Properties
| Compound Name | isoquinolin-4-yl 2-nitroacetate |
| PubChem CID | 139660360 |
| Molecular Formula | C11H8N2O4 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | isoquinolin-4-yl 2-nitroacetate |
| SMILES | O=C(C[N+](=O)[O-])Oc1cncc2ccccc12 |
| InChI | InChI=1S/C11H8N2O4/c14-11(7-13(15)16)17-10-6-12-5-8-3-1-2-4-9(8)10/h1-6H,7H2 |
| InChIKey | SCLRHQRJYWQLDD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze isoquinolin-4-yl 2-nitroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinolin-4-yl 2-nitroacetate?
The IUPAC name of isoquinolin-4-yl 2-nitroacetate (CID 139660360) is isoquinolin-4-yl 2-nitroacetate.
What is the SMILES notation for isoquinolin-4-yl 2-nitroacetate?
The canonical SMILES for isoquinolin-4-yl 2-nitroacetate is O=C(C[N+](=O)[O-])Oc1cncc2ccccc12.
What is the InChIKey of isoquinolin-4-yl 2-nitroacetate?
The InChIKey is SCLRHQRJYWQLDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O4/c14-11(7-13(15)16)17-10-6-12-5-8-3-1-2-4-9(8)10/h1-6H,7H2.
What are the key properties of isoquinolin-4-yl 2-nitroacetate?
isoquinolin-4-yl 2-nitroacetate has a molecular weight of 232.20 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinolin-4-yl 2-nitroacetate is sourced from PubChem (CID 139660360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).