C7H9FN2O2 — CID 139660900
5-(2-fluoroethyl)-1-methylpyrimidine-2,4-dione (PubChem CID 139660900) has the molecular formula C7H9FN2O2 and a molecular weight of 172.16 g/mol. Its IUPAC name is 5-(2-fluoroethyl)-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-(2-fluoroethyl)-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139660900 |
| Molecular Formula | C7H9FN2O2 |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 5-(2-fluoroethyl)-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc(CCF)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H9FN2O2/c1-10-4-5(2-3-8)6(11)9-7(10)12/h4H,2-3H2,1H3,(H,9,11,12) |
| InChIKey | CIWREDJVAKLULX-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |