C24H17NO4S2 — CID 139661405
[2-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]methoxy]phenyl] benzoate (PubChem CID 139661405) has the molecular formula C24H17NO4S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is [2-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]methoxy]phenyl] benzoate.
| Compound Name | [2-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]methoxy]phenyl] benzoate |
|---|---|
| PubChem CID | 139661405 |
| Molecular Formula | C24H17NO4S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | [2-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]methoxy]phenyl] benzoate |
| SMILES | O=C1NC(=S)SC1=Cc1cccc(COc2ccccc2OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H17NO4S2/c26-22-21(31-24(30)25-22)14-16-7-6-8-17(13-16)15-28-19-11-4-5-12-20(19)29-23(27)18-9-2-1-3-10-18/h1-14H,15H2,(H,25,26,30) |
| InChIKey | IQGQNMMLPHYAGF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|