C19H13NO3S2 — CID 71558614
[2-[(E,3Z)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)prop-1-enyl]phenyl] benzoate (PubChem CID 71558614) has the molecular formula C19H13NO3S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is [2-[(E,3Z)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)prop-1-enyl]phenyl] benzoate.
| Compound Name | [2-[(E,3Z)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)prop-1-enyl]phenyl] benzoate |
|---|---|
| PubChem CID | 71558614 |
| Molecular Formula | C19H13NO3S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | [2-[(E,3Z)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)prop-1-enyl]phenyl] benzoate |
| SMILES | O=C1NC(=S)S/C1=C\C=C\c1ccccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H13NO3S2/c21-17-16(25-19(24)20-17)12-6-10-13-7-4-5-11-15(13)23-18(22)14-8-2-1-3-9-14/h1-12H,(H,20,21,24)/b10-6+,16-12- |
| InChIKey | MGSWWYPESHUEOY-GPIDLQMLSA-N |
| XLogP | 3.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|