C29H28N2O2 — CID 139662263
2-cyclohex-3-en-1-yl-N-[4-(6,11-dihydrobenzo[c][1]benzazepine-5-carbonyl)phenyl]acetamide (PubChem CID 139662263) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-N-[4-(6,11-dihydrobenzo[c][1]benzazepine-5-carbonyl)phenyl]acetamide.
| Compound Name | 2-cyclohex-3-en-1-yl-N-[4-(6,11-dihydrobenzo[c][1]benzazepine-5-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 139662263 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-N-[4-(6,11-dihydrobenzo[c][1]benzazepine-5-carbonyl)phenyl]acetamide |
| SMILES | O=C(CC1CC=CCC1)Nc1ccc(C(=O)N2Cc3ccccc3Cc3ccccc32)cc1 |
| InChI | InChI=1S/C29H28N2O2/c32-28(18-21-8-2-1-3-9-21)30-26-16-14-22(15-17-26)29(33)31-20-25-12-5-4-10-23(25)19-24-11-6-7-13-27(24)31/h1-2,4-7,10-17,21H,3,8-9,18-20H2,(H,30,32) |
| InChIKey | STBSUACYMDFNOV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|