About 2,5-bis(hex-3-enyl)-2,3-dihydrofuran
2,5-bis(hex-3-enyl)-2,3-dihydrofuran (PubChem CID 139662910) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is 2,5-bis(hex-3-enyl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 2,5-bis(hex-3-enyl)-2,3-dihydrofuran |
| PubChem CID | 139662910 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2,5-bis(hex-3-enyl)-2,3-dihydrofuran |
| SMILES | CCC=CCCC1=CCC(CCC=CCC)O1 |
| InChI | InChI=1S/C16H26O/c1-3-5-7-9-11-15-13-14-16(17-15)12-10-8-6-4-2/h5-8,13,16H,3-4,9-12,14H2,1-2H3 |
| InChIKey | ZOEMOJRFMRALQJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(hex-3-enyl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(hex-3-enyl)-2,3-dihydrofuran?
The IUPAC name of 2,5-bis(hex-3-enyl)-2,3-dihydrofuran (CID 139662910) is 2,5-bis(hex-3-enyl)-2,3-dihydrofuran.
What is the SMILES notation for 2,5-bis(hex-3-enyl)-2,3-dihydrofuran?
The canonical SMILES for 2,5-bis(hex-3-enyl)-2,3-dihydrofuran is CCC=CCCC1=CCC(CCC=CCC)O1.
What is the InChIKey of 2,5-bis(hex-3-enyl)-2,3-dihydrofuran?
The InChIKey is ZOEMOJRFMRALQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O/c1-3-5-7-9-11-15-13-14-16(17-15)12-10-8-6-4-2/h5-8,13,16H,3-4,9-12,14H2,1-2H3.
What are the key properties of 2,5-bis(hex-3-enyl)-2,3-dihydrofuran?
2,5-bis(hex-3-enyl)-2,3-dihydrofuran has a molecular weight of 234.38 g/mol, XLogP of 5.15, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(hex-3-enyl)-2,3-dihydrofuran is sourced from PubChem (CID 139662910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).