C16H26O — CID 139662910
2,5-bis(hex-3-enyl)-2,3-dihydrofuran (PubChem CID 139662910) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 2,5-bis(hex-3-enyl)-2,3-dihydrofuran.
| Compound Name | 2,5-bis(hex-3-enyl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 139662910 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2,5-bis(hex-3-enyl)-2,3-dihydrofuran |
| SMILES | CCC=CCCC1=CCC(CCC=CCC)O1 |
| InChI | InChI=1S/C16H26O/c1-3-5-7-9-11-15-13-14-16(17-15)12-10-8-6-4-2/h5-8,13,16H,3-4,9-12,14H2,1-2H3 |
| InChIKey | ZOEMOJRFMRALQJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|