C16H28O2 — CID 161257721
(1R,2R,5S,6R)-6-ethylbicyclo[3.1.0]hexan-2-ol;(2R)-2-[(Z)-hex-3-enyl]oxirane (PubChem CID 161257721) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1R,2R,5S,6R)-6-ethylbicyclo[3.1.0]hexan-2-ol;(2R)-2-[(Z)-hex-3-enyl]oxirane.
| Compound Name | (1R,2R,5S,6R)-6-ethylbicyclo[3.1.0]hexan-2-ol;(2R)-2-[(Z)-hex-3-enyl]oxirane |
|---|---|
| PubChem CID | 161257721 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (1R,2R,5S,6R)-6-ethylbicyclo[3.1.0]hexan-2-ol;(2R)-2-[(Z)-hex-3-enyl]oxirane |
| SMILES | CC/C=C\CC[C@@H]1CO1.CC[C@@H]1[C@@H]2CC[C@@H](O)[C@H]12 |
| InChI | InChI=1S/2C8H14O/c1-2-5-6-3-4-7(9)8(5)6;1-2-3-4-5-6-8-7-9-8/h5-9H,2-4H2,1H3;3-4,8H,2,5-7H2,1H3/b;4-3-/t5-,6+,7-,8-;8-/m11/s1 |
| InChIKey | VCDLXAXYCHOQJZ-NXEGLBNQSA-N |
| XLogP | 3.54 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|