C23H38O2 — CID 46238914
2-methoxy-3,3-dimethyl-6-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]oxane (PubChem CID 46238914) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 2-methoxy-3,3-dimethyl-6-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]oxane.
| Compound Name | 2-methoxy-3,3-dimethyl-6-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]oxane |
|---|---|
| PubChem CID | 46238914 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 2-methoxy-3,3-dimethyl-6-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]oxane |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC1CCC(C)(C)C(OC)O1 |
| InChI | InChI=1S/C23H38O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-20-23(2,3)22(24-4)25-21/h6-7,9-10,12-13,15-16,21-22H,5,8,11,14,17-20H2,1-4H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | CBXYPDNNZSRGMR-DOFZRALJSA-N |
| XLogP | 6.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|