C7H7BrO3 — CID 139662913
(1S,5R)-3-bromo-2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (PubChem CID 139662913) has the molecular formula C7H7BrO3 and a molecular weight of 219.03 g/mol. Its IUPAC name is (1S,5R)-3-bromo-2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
| Compound Name | (1S,5R)-3-bromo-2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
|---|---|
| PubChem CID | 139662913 |
| Molecular Formula | C7H7BrO3 |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 217.96 |
| IUPAC Name | (1S,5R)-3-bromo-2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| SMILES | CC1=C(Br)C(=O)[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C7H7BrO3/c1-3-4-2-10-7(11-4)6(9)5(3)8/h4,7H,2H2,1H3/t4-,7-/m1/s1 |
| InChIKey | CXBPRLDIFAEPPV-CLZZGJSISA-N |
| XLogP | 0.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|