C17H30OSSi — CID 139666777
trimethyl(1-phenylsulfanyloctan-2-yloxy)silane (PubChem CID 139666777) has the molecular formula C17H30OSSi and a molecular weight of 310.58 g/mol. Its IUPAC name is trimethyl(1-phenylsulfanyloctan-2-yloxy)silane.
| Compound Name | trimethyl(1-phenylsulfanyloctan-2-yloxy)silane |
|---|---|
| PubChem CID | 139666777 |
| Molecular Formula | C17H30OSSi |
| Molecular Weight | 310.58 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | trimethyl(1-phenylsulfanyloctan-2-yloxy)silane |
| SMILES | CCCCCCC(CSc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C17H30OSSi/c1-5-6-7-9-12-16(18-20(2,3)4)15-19-17-13-10-8-11-14-17/h8,10-11,13-14,16H,5-7,9,12,15H2,1-4H3 |
| InChIKey | QXDCNBZPYKVQPU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|