C37H37Cl2N7O3 — CID 139676460
6-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-N-[5-(1H-indol-6-ylcarbamoyl)-1-methylpyrrol-3-yl]-1H-indole-2-carboxamide (PubChem CID 139676460) has the molecular formula C37H37Cl2N7O3 and a molecular weight of 698.66 g/mol. Its IUPAC name is 6-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-N-[5-(1H-indol-6-ylcarbamoyl)-1-methylpyrrol-3-yl]-1H-indole-2-carboxamide.
| Compound Name | 6-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-N-[5-(1H-indol-6-ylcarbamoyl)-1-methylpyrrol-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 139676460 |
| Molecular Formula | C37H37Cl2N7O3 |
| Molecular Weight | 698.66 g/mol |
| Exact Mass | 697.23 |
| IUPAC Name | 6-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-N-[5-(1H-indol-6-ylcarbamoyl)-1-methylpyrrol-3-yl]-1H-indole-2-carboxamide |
| SMILES | Cn1cc(NC(=O)c2cc3ccc(NC(=O)CCCc4ccc(N(CCCl)CCCl)cc4)cc3[nH]2)cc1C(=O)Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C37H37Cl2N7O3/c1-45-23-29(22-34(45)37(49)42-28-9-7-25-13-16-40-31(25)20-28)43-36(48)33-19-26-8-10-27(21-32(26)44-33)41-35(47)4-2-3-24-5-11-30(12-6-24)46(17-14-38)18-15-39/h5-13,16,19-23,40,44H,2-4,14-15,17-18H2,1H3,(H,41,47)(H,42,49)(H,43,48) |
| InChIKey | NOIUFBXCJKOEMB-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.66 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|