About propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate
propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate (PubChem CID 139683061) has the molecular formula C16H15F3N2O3
and a molecular weight of 340.30 g/mol. Its IUPAC name is propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate.
Molecular Properties
| Compound Name | propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate |
| PubChem CID | 139683061 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate |
| SMILES | CCCOC(=O)c1ccc(-c2ncc(C(O)C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C16H15F3N2O3/c1-2-7-24-15(23)11-5-3-10(4-6-11)14-20-8-12(9-21-14)13(22)16(17,18)19/h3-6,8-9,13,22H,2,7H2,1H3 |
| InChIKey | BCPQASKMCYTQPO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate?
The IUPAC name of propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate (CID 139683061) is propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate.
What is the SMILES notation for propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate?
The canonical SMILES for propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate is CCCOC(=O)c1ccc(-c2ncc(C(O)C(F)(F)F)cn2)cc1.
What is the InChIKey of propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate?
The InChIKey is BCPQASKMCYTQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3N2O3/c1-2-7-24-15(23)11-5-3-10(4-6-11)14-20-8-12(9-21-14)13(22)16(17,18)19/h3-6,8-9,13,22H,2,7H2,1H3.
What are the key properties of propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate?
propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate has a molecular weight of 340.30 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4-[5-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]benzoate is sourced from PubChem (CID 139683061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).