C20H38S — CID 139683380
1-methyl-1-(5-methyl-2-propan-2-ylcyclohexyl)sulfanyl-4-propan-2-ylcyclohexane (PubChem CID 139683380) has the molecular formula C20H38S and a molecular weight of 310.59 g/mol. Its IUPAC name is 1-methyl-1-(5-methyl-2-propan-2-ylcyclohexyl)sulfanyl-4-propan-2-ylcyclohexane.
| Compound Name | 1-methyl-1-(5-methyl-2-propan-2-ylcyclohexyl)sulfanyl-4-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 139683380 |
| Molecular Formula | C20H38S |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 1-methyl-1-(5-methyl-2-propan-2-ylcyclohexyl)sulfanyl-4-propan-2-ylcyclohexane |
| SMILES | CC1CCC(C(C)C)C(SC2(C)CCC(C(C)C)CC2)C1 |
| InChI | InChI=1S/C20H38S/c1-14(2)17-9-11-20(6,12-10-17)21-19-13-16(5)7-8-18(19)15(3)4/h14-19H,7-13H2,1-6H3 |
| InChIKey | MPGPAQGWSXNHBS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |