C44H84O8S3Sn — CID 139683681
[bis[[8-methyl-2-(sulfanylmethyl)nonanoyl]oxy]-(3-octoxy-3-oxopropyl)stannyl] 8-methyl-2-(sulfanylmethyl)nonanoate (PubChem CID 139683681) has the molecular formula C44H84O8S3Sn and a molecular weight of 956.06 g/mol. Its IUPAC name is [bis[[8-methyl-2-(sulfanylmethyl)nonanoyl]oxy]-(3-octoxy-3-oxopropyl)stannyl] 8-methyl-2-(sulfanylmethyl)nonanoate.
| Compound Name | [bis[[8-methyl-2-(sulfanylmethyl)nonanoyl]oxy]-(3-octoxy-3-oxopropyl)stannyl] 8-methyl-2-(sulfanylmethyl)nonanoate |
|---|---|
| PubChem CID | 139683681 |
| Molecular Formula | C44H84O8S3Sn |
| Molecular Weight | 956.06 g/mol |
| Exact Mass | 956.44 |
| IUPAC Name | [bis[[8-methyl-2-(sulfanylmethyl)nonanoyl]oxy]-(3-octoxy-3-oxopropyl)stannyl] 8-methyl-2-(sulfanylmethyl)nonanoate |
| SMILES | CCCCCCCCOC(=O)CC[Sn](OC(=O)C(CS)CCCCCC(C)C)(OC(=O)C(CS)CCCCCC(C)C)OC(=O)C(CS)CCCCCC(C)C |
| InChI | InChI=1S/3C11H22O2S.C11H21O2.Sn/c3*1-9(2)6-4-3-5-7-10(8-14)11(12)13;1-3-5-6-7-8-9-10-13-11(12)4-2;/h3*9-10,14H,3-8H2,1-2H3,(H,12,13);2-10H2,1H3;/q;;;;+3/p-3 |
| InChIKey | MGRWGBIFWSPAAB-UHFFFAOYSA-K |
| XLogP | 12.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.06 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|