C30H60O4S2Sn — CID 140591803
[dibutyl-[8-methyl-2-(sulfanylmethyl)nonanoyl]oxystannyl] 8-methyl-2-(sulfanylmethyl)nonanoate (PubChem CID 140591803) has the molecular formula C30H60O4S2Sn and a molecular weight of 667.65 g/mol. Its IUPAC name is [dibutyl-[8-methyl-2-(sulfanylmethyl)nonanoyl]oxystannyl] 8-methyl-2-(sulfanylmethyl)nonanoate.
| Compound Name | [dibutyl-[8-methyl-2-(sulfanylmethyl)nonanoyl]oxystannyl] 8-methyl-2-(sulfanylmethyl)nonanoate |
|---|---|
| PubChem CID | 140591803 |
| Molecular Formula | C30H60O4S2Sn |
| Molecular Weight | 667.65 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | [dibutyl-[8-methyl-2-(sulfanylmethyl)nonanoyl]oxystannyl] 8-methyl-2-(sulfanylmethyl)nonanoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)C(CS)CCCCCC(C)C)OC(=O)C(CS)CCCCCC(C)C |
| InChI | InChI=1S/2C11H22O2S.2C4H9.Sn/c2*1-9(2)6-4-3-5-7-10(8-14)11(12)13;2*1-3-4-2;/h2*9-10,14H,3-8H2,1-2H3,(H,12,13);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | WPOOSSRZRBISJU-UHFFFAOYSA-L |
| XLogP | 9.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.65 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|