C20H42N2O4Sn — CID 141249453
[dibutyl-[2-(methylamino)pentanoyloxy]stannyl] 2-(methylamino)pentanoate (PubChem CID 141249453) has the molecular formula C20H42N2O4Sn and a molecular weight of 493.28 g/mol. Its IUPAC name is [dibutyl-[2-(methylamino)pentanoyloxy]stannyl] 2-(methylamino)pentanoate.
| Compound Name | [dibutyl-[2-(methylamino)pentanoyloxy]stannyl] 2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 141249453 |
| Molecular Formula | C20H42N2O4Sn |
| Molecular Weight | 493.28 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | [dibutyl-[2-(methylamino)pentanoyloxy]stannyl] 2-(methylamino)pentanoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)C(CCC)NC)OC(=O)C(CCC)NC |
| InChI | InChI=1S/2C6H13NO2.2C4H9.Sn/c2*1-3-4-5(7-2)6(8)9;2*1-3-4-2;/h2*5,7H,3-4H2,1-2H3,(H,8,9);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | AJVXGUFMJXTYFU-UHFFFAOYSA-L |
| XLogP | 3.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |