C18H36O4S2Sn — CID 139785453
[dibutyl-(2-methyl-4-sulfanylbutanoyl)oxystannyl] 2-methyl-4-sulfanylbutanoate (PubChem CID 139785453) has the molecular formula C18H36O4S2Sn and a molecular weight of 499.33 g/mol. Its IUPAC name is [dibutyl-(2-methyl-4-sulfanylbutanoyl)oxystannyl] 2-methyl-4-sulfanylbutanoate.
| Compound Name | [dibutyl-(2-methyl-4-sulfanylbutanoyl)oxystannyl] 2-methyl-4-sulfanylbutanoate |
|---|---|
| PubChem CID | 139785453 |
| Molecular Formula | C18H36O4S2Sn |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | [dibutyl-(2-methyl-4-sulfanylbutanoyl)oxystannyl] 2-methyl-4-sulfanylbutanoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)C(C)CCS)OC(=O)C(C)CCS |
| InChI | InChI=1S/2C5H10O2S.2C4H9.Sn/c2*1-4(2-3-8)5(6)7;2*1-3-4-2;/h2*4,8H,2-3H2,1H3,(H,6,7);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | KAWYXDCBMCUYRX-UHFFFAOYSA-L |
| XLogP | 5.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|