C26H52O4S2Sn — CID 139785524
[(2-methyl-4-sulfanylbutanoyl)oxy-dioctylstannyl] 2-methyl-4-sulfanylbutanoate (PubChem CID 139785524) has the molecular formula C26H52O4S2Sn and a molecular weight of 611.54 g/mol. Its IUPAC name is [(2-methyl-4-sulfanylbutanoyl)oxy-dioctylstannyl] 2-methyl-4-sulfanylbutanoate.
| Compound Name | [(2-methyl-4-sulfanylbutanoyl)oxy-dioctylstannyl] 2-methyl-4-sulfanylbutanoate |
|---|---|
| PubChem CID | 139785524 |
| Molecular Formula | C26H52O4S2Sn |
| Molecular Weight | 611.54 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | [(2-methyl-4-sulfanylbutanoyl)oxy-dioctylstannyl] 2-methyl-4-sulfanylbutanoate |
| SMILES | CCCCCCCC[Sn](CCCCCCCC)(OC(=O)C(C)CCS)OC(=O)C(C)CCS |
| InChI | InChI=1S/2C8H17.2C5H10O2S.Sn/c2*1-3-5-7-8-6-4-2;2*1-4(2-3-8)5(6)7;/h2*1,3-8H2,2H3;2*4,8H,2-3H2,1H3,(H,6,7);/q;;;;+2/p-2 |
| InChIKey | HMFFSFQAIGLILO-UHFFFAOYSA-L |
| XLogP | 8.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.54 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|