C38H76O4S2Sn — CID 139673411
[2-(2-ethylhexylsulfanyl)propanoyloxy-dioctylstannyl] 2-(2-ethylhexylsulfanyl)propanoate (PubChem CID 139673411) has the molecular formula C38H76O4S2Sn and a molecular weight of 779.87 g/mol. Its IUPAC name is [2-(2-ethylhexylsulfanyl)propanoyloxy-dioctylstannyl] 2-(2-ethylhexylsulfanyl)propanoate.
| Compound Name | [2-(2-ethylhexylsulfanyl)propanoyloxy-dioctylstannyl] 2-(2-ethylhexylsulfanyl)propanoate |
|---|---|
| PubChem CID | 139673411 |
| Molecular Formula | C38H76O4S2Sn |
| Molecular Weight | 779.87 g/mol |
| Exact Mass | 780.42 |
| IUPAC Name | [2-(2-ethylhexylsulfanyl)propanoyloxy-dioctylstannyl] 2-(2-ethylhexylsulfanyl)propanoate |
| SMILES | CCCCCCCC[Sn](CCCCCCCC)(OC(=O)C(C)SCC(CC)CCCC)OC(=O)C(C)SCC(CC)CCCC |
| InChI | InChI=1S/2C11H22O2S.2C8H17.Sn/c2*1-4-6-7-10(5-2)8-14-9(3)11(12)13;2*1-3-5-7-8-6-4-2;/h2*9-10H,4-8H2,1-3H3,(H,12,13);2*1,3-8H2,2H3;/q;;;;+2/p-2 |
| InChIKey | CAWFGLZVKAGWCV-UHFFFAOYSA-L |
| XLogP | 12.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.87 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|