C22H44O4S2Sn — CID 139785507
[(2-methylsulfanylacetyl)oxy-dioctylstannyl] 2-methylsulfanylacetate (PubChem CID 139785507) has the molecular formula C22H44O4S2Sn and a molecular weight of 555.44 g/mol. Its IUPAC name is [(2-methylsulfanylacetyl)oxy-dioctylstannyl] 2-methylsulfanylacetate.
| Compound Name | [(2-methylsulfanylacetyl)oxy-dioctylstannyl] 2-methylsulfanylacetate |
|---|---|
| PubChem CID | 139785507 |
| Molecular Formula | C22H44O4S2Sn |
| Molecular Weight | 555.44 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | [(2-methylsulfanylacetyl)oxy-dioctylstannyl] 2-methylsulfanylacetate |
| SMILES | CCCCCCCC[Sn](CCCCCCCC)(OC(=O)CSC)OC(=O)CSC |
| InChI | InChI=1S/2C8H17.2C3H6O2S.Sn/c2*1-3-5-7-8-6-4-2;2*1-6-2-3(4)5;/h2*1,3-8H2,2H3;2*2H2,1H3,(H,4,5);/q;;;;+2/p-2 |
| InChIKey | RTMKJHKPSQEMEX-UHFFFAOYSA-L |
| XLogP | 6.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.44 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|