C32H64O4S2Sn — CID 139892414
[(2-hexylsulfanylacetyl)oxy-dioctylstannyl] 2-hexylsulfanylacetate (PubChem CID 139892414) has the molecular formula C32H64O4S2Sn and a molecular weight of 695.70 g/mol. Its IUPAC name is [(2-hexylsulfanylacetyl)oxy-dioctylstannyl] 2-hexylsulfanylacetate.
| Compound Name | [(2-hexylsulfanylacetyl)oxy-dioctylstannyl] 2-hexylsulfanylacetate |
|---|---|
| PubChem CID | 139892414 |
| Molecular Formula | C32H64O4S2Sn |
| Molecular Weight | 695.70 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | [(2-hexylsulfanylacetyl)oxy-dioctylstannyl] 2-hexylsulfanylacetate |
| SMILES | CCCCCCCC[Sn](CCCCCCCC)(OC(=O)CSCCCCCC)OC(=O)CSCCCCCC |
| InChI | InChI=1S/2C8H16O2S.2C8H17.Sn/c2*1-2-3-4-5-6-11-7-8(9)10;2*1-3-5-7-8-6-4-2;/h2*2-7H2,1H3,(H,9,10);2*1,3-8H2,2H3;/q;;;;+2/p-2 |
| InChIKey | HURKFNQYPNXRLX-UHFFFAOYSA-L |
| XLogP | 10.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.70 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|