About [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate
[butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate (PubChem CID 139668459) has the molecular formula C34H66O6S3Sn
and a molecular weight of 785.81 g/mol. Its IUPAC name is [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate.
Molecular Properties
| Compound Name | [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate |
| PubChem CID | 139668459 |
| Molecular Formula | C34H66O6S3Sn |
| Molecular Weight | 785.81 g/mol |
| Exact Mass | 786.30 |
| IUPAC Name | [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate |
| SMILES | CCCCCCCCSCC(=O)O[Sn](CCCC)(OC(=O)CSCCCCCCCC)OC(=O)CSCCCCCCCC |
| InChI | InChI=1S/3C10H20O2S.C4H9.Sn/c3*1-2-3-4-5-6-7-8-13-9-10(11)12;1-3-4-2;/h3*2-9H2,1H3,(H,11,12);1,3-4H2,2H3;/q;;;;+3/p-3 |
| InChIKey | ZUSPUVLQZAKOMX-UHFFFAOYSA-K |
| XLogP | 10.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 785.81 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate?
The IUPAC name of [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate (CID 139668459) is [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate.
What is the SMILES notation for [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate?
The canonical SMILES for [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate is CCCCCCCCSCC(=O)O[Sn](CCCC)(OC(=O)CSCCCCCCCC)OC(=O)CSCCCCCCCC.
What is the InChIKey of [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate?
The InChIKey is ZUSPUVLQZAKOMX-UHFFFAOYSA-K. The full InChI is InChI=1S/3C10H20O2S.C4H9.Sn/c3*1-2-3-4-5-6-7-8-13-9-10(11)12;1-3-4-2;/h3*2-9H2,1H3,(H,11,12);1,3-4H2,2H3;/q;;;;+3/p-3.
What are the key properties of [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate?
[butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate has a molecular weight of 785.81 g/mol, XLogP of 10.64, 33 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [butyl-bis[(2-octylsulfanylacetyl)oxy]stannyl] 2-octylsulfanylacetate is sourced from PubChem (CID 139668459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).