C16H32O4Sn — CID 16684199
[butanoyloxy(dibutyl)stannyl] butanoate (PubChem CID 16684199) has the molecular formula C16H32O4Sn and a molecular weight of 407.14 g/mol. Its IUPAC name is [butanoyloxy(dibutyl)stannyl] butanoate.
| Compound Name | [butanoyloxy(dibutyl)stannyl] butanoate |
|---|---|
| PubChem CID | 16684199 |
| Molecular Formula | C16H32O4Sn |
| Molecular Weight | 407.14 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [butanoyloxy(dibutyl)stannyl] butanoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/2C4H8O2.2C4H9.Sn/c2*1-2-3-4(5)6;2*1-3-4-2;/h2*2-3H2,1H3,(H,5,6);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | DWRBCWYHLKHQAP-UHFFFAOYSA-L |
| XLogP | 4.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.14 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |