C28H56O4Sn — CID 90470537
[dibutyl(7,7-dimethyloctanoyloxy)stannyl] 7,7-dimethyloctanoate (PubChem CID 90470537) has the molecular formula C28H56O4Sn and a molecular weight of 575.46 g/mol. Its IUPAC name is [dibutyl(7,7-dimethyloctanoyloxy)stannyl] 7,7-dimethyloctanoate.
| Compound Name | [dibutyl(7,7-dimethyloctanoyloxy)stannyl] 7,7-dimethyloctanoate |
|---|---|
| PubChem CID | 90470537 |
| Molecular Formula | C28H56O4Sn |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | [dibutyl(7,7-dimethyloctanoyloxy)stannyl] 7,7-dimethyloctanoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)CCCCCC(C)(C)C)OC(=O)CCCCCC(C)(C)C |
| InChI | InChI=1S/2C10H20O2.2C4H9.Sn/c2*1-10(2,3)8-6-4-5-7-9(11)12;2*1-3-4-2;/h2*4-8H2,1-3H3,(H,11,12);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | SRBBGWHVUDXXMK-UHFFFAOYSA-L |
| XLogP | 9.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|