C26H52O4Sn — CID 140559199
[9,9-dimethyldecanoyloxy(dimethyl)stannyl] 9,9-dimethyldecanoate (PubChem CID 140559199) has the molecular formula C26H52O4Sn and a molecular weight of 547.41 g/mol. Its IUPAC name is [9,9-dimethyldecanoyloxy(dimethyl)stannyl] 9,9-dimethyldecanoate.
| Compound Name | [9,9-dimethyldecanoyloxy(dimethyl)stannyl] 9,9-dimethyldecanoate |
|---|---|
| PubChem CID | 140559199 |
| Molecular Formula | C26H52O4Sn |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | [9,9-dimethyldecanoyloxy(dimethyl)stannyl] 9,9-dimethyldecanoate |
| SMILES | CC(C)(C)CCCCCCCC(=O)O[Sn](C)(C)OC(=O)CCCCCCCC(C)(C)C |
| InChI | InChI=1S/2C12H24O2.2CH3.Sn/c2*1-12(2,3)10-8-6-4-5-7-9-11(13)14;;;/h2*4-10H2,1-3H3,(H,13,14);2*1H3;/q;;;;+2/p-2 |
| InChIKey | IIBOCEMBXRAEDP-UHFFFAOYSA-L |
| XLogP | 8.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|